213178-97-3 Usage
General Description
AC-DL-HIS-OH H2O refers to the chemical compound L-histidine, which is an α-amino acid that is essential for protein synthesis in the human body. It is commonly found in high-protein foods such as meat, poultry, fish, dairy products, and eggs. L-histidine is known for its role in the formation of histamine, a compound involved in allergic reactions and immune responses. It also plays a crucial role in the production of red and white blood cells, and in the maintenance of the myelin sheath that protects nerve cells. Additionally, L-histidine is a precursor to the synthesis of the neurotransmitter histamine and the dipeptide carnosine, both of which have been studied for their potential health benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 213178-97-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,3,1,7 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 213178-97:
(8*2)+(7*1)+(6*3)+(5*1)+(4*7)+(3*8)+(2*9)+(1*7)=123
123 % 10 = 3
So 213178-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O3.H2O/c1-5(12)11-7(8(13)14)2-6-3-9-4-10-6;/h3-4,7H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14);1H2
