213211-69-9 Usage
Description
2-Ethoxyphenylboronic acid is an organic compound that exists as white to off-white crystals or a crystalline powder. It is a boronic acid derivative with a chemical structure featuring an ethoxy group attached to a phenyl ring, which is further connected to a boronic acid group. This unique structure endows it with versatile reactivity and utility in various chemical reactions and applications.
Uses
Used in Pharmaceutical Industry:
2-Ethoxyphenylboronic acid is used as a reactant for the synthesis of various pharmaceutical compounds, including pyridines and pyrimidines, which are important building blocks in the development of new drugs. Its involvement in Suzuki-Miyaura cross-coupling reactions allows for the formation of complex molecular structures with potential therapeutic applications.
Used in Chemical Research:
2-Ethoxyphenylboronic acid is used as a reactant in various chemical research applications, such as the synthesis of bromo-N-methylpyrrole and diarylbenzophenones. These compounds have potential uses in the development of new materials and chemicals with specific properties.
Used in Catalyst Development:
2-Ethoxyphenylboronic acid is used as a reactant in the study of the effect of biaryl phosphine ligand structure on C-N and C-C bond formation. This research is crucial for the development of more efficient and selective catalysts for various chemical reactions.
Used in Material Science:
2-Ethoxyphenylboronic acid is used as a reactant in oxidative coupling via C-H arylation, a process that can lead to the formation of new materials with unique properties. This application is particularly relevant in the field of material science, where the development of novel materials with specific characteristics is of great interest.
Check Digit Verification of cas no
The CAS Registry Mumber 213211-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,3,2,1 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 213211-69:
(8*2)+(7*1)+(6*3)+(5*2)+(4*1)+(3*1)+(2*6)+(1*9)=79
79 % 10 = 9
So 213211-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H11BO3/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6,10-11H,2H2,1H3