21446-35-5 Usage
Description
Guatteguamerine is an aromatic ether compound that is formed through the oxidative dimerization between the 4-hydroxy group of one molecule of (1R)-1-(4-hydroxybenzyl)-6-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol and the 3-position of the 4-hydroxybenzyl group of another molecule.
Uses
1. Used in Pharmaceutical Industry:
Guatteguamerine is used as a pharmaceutical compound for its potential therapeutic applications. The compound's unique structure and properties make it a promising candidate for the development of new drugs and therapies.
2. Used in Chemical Research:
Guatteguamerine is utilized as a research compound in the field of chemistry, particularly in the study of aromatic ethers and their reactions, as well as in the investigation of oxidative dimerization processes.
3. Used in Drug Development:
Guatteguamerine serves as a starting point for the development of new drugs, as its structure can be modified and optimized to target specific biological pathways or receptors.
4. Used in Analytical Chemistry:
Guatteguamerine can be employed as a reference compound or standard in analytical chemistry, helping to validate and calibrate analytical methods and techniques.
5. Used in Material Science:
The unique properties of guatteguamerine may also find applications in material science, where it could be used to develop new materials with specific characteristics or functions.
Check Digit Verification of cas no
The CAS Registry Mumber 21446-35-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,4 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 21446-35:
(7*2)+(6*1)+(5*4)+(4*4)+(3*6)+(2*3)+(1*5)=85
85 % 10 = 5
So 21446-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C36H40N2O6/c1-37-13-11-24-18-34(42-3)32(40)20-27(24)29(37)15-22-5-8-26(9-6-22)44-36-17-23(7-10-31(36)39)16-30-28-21-33(41)35(43-4)19-25(28)12-14-38(30)2/h5-10,17-21,29-30,39-41H,11-16H2,1-4H3/t29-,30-/m1/s1