217962-82-8 Usage
Description
2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester is a synthetic organic compound with the molecular formula C13H19N3O3S. It contains both amino and carboxylic acid functional groups, making it potentially useful for the development of new drugs and crop protection products. Its ethyl ester form also makes it a potential candidate for use as a solvent or intermediate in chemical synthesis processes.
Uses
Used in Pharmaceutical Industry:
2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester is used as a potential candidate for the development of new drugs due to its unique chemical structure and functional groups.
Used in Agrochemical Industry:
2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester is used as a potential candidate for the development of new crop protection products, such as pesticides or herbicides, due to its potential bioactivity and chemical properties.
Used as a Solvent:
2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester is used as a potential solvent in chemical synthesis processes due to its ethyl ester form.
Used as an Intermediate in Chemical Synthesis:
2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester is used as an intermediate in the synthesis of other chemical compounds, taking advantage of its reactive functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 217962-82-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,7,9,6 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 217962-82:
(8*2)+(7*1)+(6*7)+(5*9)+(4*6)+(3*2)+(2*8)+(1*2)=158
158 % 10 = 8
So 217962-82-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O3S/c1-5-16-11(15)7-6(2)8(17-9(7)12)10(14)13(3)4/h5,12H2,1-4H3
