2184-86-3 Usage
Description
(2R)-2-(2,4-dichlorophenyl)pentanenitrile is a chiral chemical compound with the molecular formula C12H13Cl2N. It features a pentanenitrile group, which is a five-carbon chain with a nitrile functional group at one end, and a 2,4-dichlorophenyl group attached to the second carbon atom. (2R)-2-(2,4-dichlorophenyl)pentanenitrile is known for its unique structure and reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Uses
Used in Pharmaceutical Industry:
(2R)-2-(2,4-dichlorophenyl)pentanenitrile is used as an intermediate in the synthesis of various pharmaceuticals for its unique structure and reactivity, contributing to the development of new medications.
Used in Agrochemical Industry:
In the agrochemical industry, (2R)-2-(2,4-dichlorophenyl)pentanenitrile serves as an intermediate in the production of agrochemicals, playing a crucial role in the synthesis of compounds that protect crops and enhance agricultural productivity.
Used in Organic Chemistry Research:
(2R)-2-(2,4-dichlorophenyl)pentanenitrile is utilized in organic chemistry research for its unique properties, enabling scientists to explore new reactions and develop innovative synthetic pathways.
Used as a Building Block in Complex Compound Production:
(2R)-2-(2,4-dichlorophenyl)pentanenitrile also serves as a building block in the production of other complex compounds, further expanding its applications across various industries that require sophisticated chemical structures.
Check Digit Verification of cas no
The CAS Registry Mumber 2184-86-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,8 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2184-86:
(6*2)+(5*1)+(4*8)+(3*4)+(2*8)+(1*6)=83
83 % 10 = 3
So 2184-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11Cl2N/c1-2-3-8(7-14)10-5-4-9(12)6-11(10)13/h4-6,8H,2-3H2,1H3/t8-/m0/s1
2184-86-3Relevant articles and documents
How iodide anions inhibit the phase-transfer catalyzed reactions of carbanions
Makosza, Mieczys?aw,Chesnokov, Alexey
, p. 5925 - 5932 (2008/12/20)
The inhibitory effect of iodide anions on the phase-transfer catalyzed reactions of carbanions generated in liquid-liquid two-phase systems by aqueous NaOH is due to preferential location of these anions in the interfacial region of the two-phase system-organic phase/concd aqueous NaOH. In such situation, the basic activity of NaOH in this region is decreased and the equilibrium of deprotonation of the carbanion precursors is disfavoured.
