21943-12-4 Usage
Description
2-Amino-3-bromopyrazine, also known as 3-bromo-2-pyrazinamine, is a substituted pyrazine derivative characterized by the presence of an amino group at the 2nd position and a bromine atom at the 3rd position. This organic compound is known for its potential applications in chemical synthesis and the development of various chemical products.
Uses
Used in Chemical Synthesis:
2-Amino-3-bromopyrazine is used as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structural features allow it to serve as a versatile building block for the creation of complex molecules with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Amino-3-bromopyrazine is utilized as a starting material for the development of novel drug candidates. Its chemical properties enable the design of new molecules with potential therapeutic effects, contributing to the advancement of medicine and healthcare.
Used in Agrochemical Industry:
2-Amino-3-bromopyrazine also finds application in the agrochemical industry, where it is employed in the synthesis of new pesticides, herbicides, and other crop protection agents. Its ability to form stable and effective compounds makes it a valuable component in the development of innovative agrochemical products.
Used in Specialty Chemicals:
In the specialty chemicals sector, 2-Amino-3-bromopyrazine is used as a component in the production of various high-value chemical products. Its unique properties allow it to be incorporated into a wide range of applications, from dyes and pigments to advanced materials and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 21943-12-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,9,4 and 3 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21943-12:
(7*2)+(6*1)+(5*9)+(4*4)+(3*3)+(2*1)+(1*2)=94
94 % 10 = 4
So 21943-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrN3/c5-3-4(6)8-2-1-7-3/h1-2H,(H2,6,8)
