220228-03-5 Usage
General Description
3,4,5-Trifluorophenylacetonitrile is a chemical compound with the molecular formula C8H4F3N. It is a nitrile, which is characterized by the presence of a carbon-nitrogen triple bond. 3,4,5-TRIFLUOROPHENYLACETONITRILE is commonly used as an intermediate or building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its trifluorophenyl group makes it a valuable starting material for the synthesis of various fluorinated organic compounds, which are often desired for their unique properties and applications. 3,4,5-Trifluorophenylacetonitrile is typically handled and stored with appropriate safety precautions due to its potentially hazardous properties.
Check Digit Verification of cas no
The CAS Registry Mumber 220228-03-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 220228-03:
(8*2)+(7*2)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*3)=75
75 % 10 = 5
So 220228-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H4F3N/c9-6-3-5(1-2-12)4-7(10)8(6)11/h3-4H,1H2
220228-03-5Relevant articles and documents
SUBSTITUTED PHENYL ETHER COMPOUND AND PEST CONTROL AGENT
-
Paragraph 0241, (2016/10/08)
PROBLEM TO BE SOLVED: To provide a novel substituted phenyl ether compound having pest controlling effect and a pest control agent comprising the compound as an active ingredient. SOLUTION: The present invention provides a substituted phenyl ether compound represented by the formula (1-2). COPYRIGHT: (C)2015,JPOandINPIT
