22116-90-1 Usage
General Description
DIMETHYL PERFLUOROAZELATE is a chemical compound known as an organofluorine compound, which contains carbon to fluorine bonds. It is part of a larger group of perfluorochemicals (PFCs), known for their distinctive physical characteristics that include high thermal stability, low reactivity, and lipophobicity - the inability to dissolve in fats or lipids. Even though detailed information about this specific compound is sparse, PFCs as a whole are used in various applications like in firefighting foams, non-stick pans, and water-proof clothing due to their unique properties. However, they are also known to be environmentally persistent and could have potential issues related to environmental contamination and toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 22116-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,1 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22116-90:
(7*2)+(6*2)+(5*1)+(4*1)+(3*6)+(2*9)+(1*0)=71
71 % 10 = 1
So 22116-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C2H2FIO2.Na/c3-1(4)2(5)6;/h1H,(H,5,6);/q;+1/p-1
