221298-00-6 Usage
Description
(3-METHYLPIPERIDIN-3-YL)METHANOL, with the chemical formula C8H17NO, is a secondary alcohol and a derivative of piperidine. It features a six-membered heterocyclic ring with one nitrogen atom, a tertiary amine group, and a hydroxyl group. This unique structure and reactivity make it a valuable building block in the synthesis of pharmaceuticals and agrochemicals.
Uses
Used in Pharmaceutical Industry:
(3-METHYLPIPERIDIN-3-YL)METHANOL is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and reactivity, which allows it to be incorporated into the development of new drugs.
Used in Agrochemical Industry:
(3-METHYLPIPERIDIN-3-YL)METHANOL is used as a building block for the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals.
Used in Medicinal Chemistry and Drug Discovery:
(3-METHYLPIPERIDIN-3-YL)METHANOL is used as a potential candidate in medicinal chemistry and drug discovery due to its ability to interact with biological targets and exhibit pharmacological activity, although further research and testing are required to fully explore its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 221298-00-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,2,9 and 8 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 221298-00:
(8*2)+(7*2)+(6*1)+(5*2)+(4*9)+(3*8)+(2*0)+(1*0)=106
106 % 10 = 6
So 221298-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO/c1-7(6-9)3-2-4-8-5-7/h8-9H,2-6H2,1H3
221298-00-6Relevant articles and documents
THIENO[3,2-C]PYRIDIN-4(5H)-ONES AS BET INHIBITORS
-
Page/Page column 131; 132, (2014/06/11)
Thienopyridone compounds of formula (I) or a salt thereof, pharmaceutical compositions containing such compounds and their use in therapy, in particular in the treatment of diseases or conditions for which a bromodomain inhibitor is indicated.
FUSED BENZENE DERIVATIVE AND USE
-
Page/Page column 41, (2010/02/12)
The present invention provides a compound represented by the general formula: [wherein Ring A represents an optionally substituted 5- to 8-membered ring, Ring B represents a further optionally substituted 4- to 10-membered ring, Ring C represents a further optionally substituted benzene ring, X1 represents carbon atom, X2 represents a carbon atom, an oxygen atom, etc., W represents a nitrogen atom, etc., Y11 represents a group represented by the formula CR2R3' (wherein R2 represents a hydrogen atom, a cyano group, a nitro group, etc., and R3' represents a hydrogen atom, a cyano group, a nitro group, etc., respectively), Y21 represents a group represented by the formula CR4R5' (wherein R4 represents a hydrogen atom, a cyano group, a nitro group, etc., and R5' represents a hydrogen atom, a cyano group, a nitro group, etc., respectively), etc., and R1 represents an electron-withdrawing group, respectively. The formula represents a single bond or a double bond] or a salt thereof, which is useful as an androgen receptor modulator.
