223595-28-6 Usage
Description
2,4-DIBROMO-3-(DIFLUOROMETHOXY)BENZOIC ACID is an organic compound characterized by its unique chemical structure, featuring two bromine atoms at the 2nd and 4th positions, and a difluoromethoxy group at the 3rd position on a benzoic acid backbone. 2,4-DIBROMO-3-(DIFLUOROMETHOXY)BENZOIC ACID is known for its potential applications in various industries due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
2,4-DIBROMO-3-(DIFLUOROMETHOXY)BENZOIC ACID is used as a reagent for the production of 7-isoindolinequinolonecarboxylic derivatives, which are known for their antibacterial properties. The compound plays a crucial role in the synthesis of these derivatives, contributing to the development of new and effective antibacterial agents to combat bacterial infections.
Check Digit Verification of cas no
The CAS Registry Mumber 223595-28-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,5,9 and 5 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 223595-28:
(8*2)+(7*2)+(6*3)+(5*5)+(4*9)+(3*5)+(2*2)+(1*8)=136
136 % 10 = 6
So 223595-28-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H4Br2F2O3/c9-4-2-1-3(7(13)14)5(10)6(4)15-8(11)12/h1-2,8H,(H,13,14)