22715-34-0 Usage
General Description
2(1H)-PyriMidinone, 4,5,6-triaMino- is a chemical compound with the molecular formula C5H6N6O. It is a pyrimidinone derivative with three amino groups attached to the pyrimidine ring. 2(1H)-PyriMidinone, 4,5,6-triaMino- is commonly used in the field of chemistry and pharmaceuticals as a building block for the synthesis of various chemical compounds and pharmaceutical drugs. It has the potential to be used as an intermediate in the production of anticancer and antiviral drugs due to its unique structure and reactivity. Its properties and reactivity make it a valuable starting material for the synthesis of diverse chemical compounds in the pharmaceutical and agrochemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 22715-34-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,7,1 and 5 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22715-34:
(7*2)+(6*2)+(5*7)+(4*1)+(3*5)+(2*3)+(1*4)=90
90 % 10 = 0
So 22715-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N5O/c5-1-2(6)8-4(10)9-3(1)7/h5H2,(H5,6,7,8,9,10)