229949-64-8 Usage
General Description
5A,6A,12A,13A-Tetrahydro-dibenzo[b,I]thianthrene-5,7,12,14-tetrone is a complex organic compound with a chemical structure characterized by its two fused benzene rings and a thianthrene unit. It also contains four oxygen atoms, which are arranged in a specific pattern within the molecule. This chemical compound has potential applications in various fields, including medicine and material science, due to its unique structure and properties. However, it also requires careful handling and research to understand its full potential and possible uses.
Check Digit Verification of cas no
The CAS Registry Mumber 229949-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,9,9,4 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 229949-64:
(8*2)+(7*2)+(6*9)+(5*9)+(4*4)+(3*9)+(2*6)+(1*4)=188
188 % 10 = 8
So 229949-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H12O4S2/c21-13-9-5-1-2-6-10(9)14(22)18-17(13)25-19-15(23)11-7-3-4-8-12(11)16(24)20(19)26-18/h1-8,17-20H