23323-37-7 Usage
Description
N-Octyl-D-glucamine, also known as 1-Deoxy-1-(octylamino)-D-glucitol, is a white to light yellow crystalline powder with unique chemical properties. It is a derivative of glucamine, an amino sugar, and features an octyl group attached to the nitrogen atom, which contributes to its specific characteristics and applications.
Uses
Used in Pharmaceutical Industry:
N-Octyl-D-glucamine is used as an intermediate in the synthesis of various pharmaceutical compounds due to its unique chemical structure and properties. It plays a crucial role in the preparation of drugs like Dexketoprofen Trometamol, a widely used analgesic and antipyretic medication.
Used in Chemical Synthesis:
In the chemical industry, N-Octyl-D-glucamine is utilized as a building block for the synthesis of various organic compounds, particularly those with biological or pharmaceutical relevance. Its unique structure allows for the creation of novel molecules with potential applications in different fields.
Used in Surface Active Agents:
Due to its amphiphilic nature, N-Octyl-D-glucamine can be used as a component in the formulation of surface-active agents, such as surfactants and emulsifiers. These agents are essential in various industries, including cosmetics, food processing, and pharmaceuticals, for their ability to reduce surface tension and stabilize mixtures.
Used in Chiral Catalysts:
N-Octyl-D-glucamine, being a chiral molecule, can be employed as a chiral catalyst in asymmetric synthesis, a crucial process in the production of enantiomerically pure compounds. These compounds are vital in the pharmaceutical industry, as they often exhibit different biological activities and are required for the development of effective drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 23323-37-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,3,2 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23323-37:
(7*2)+(6*3)+(5*3)+(4*2)+(3*3)+(2*3)+(1*7)=77
77 % 10 = 7
So 23323-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H31NO5/c1-2-3-4-5-6-7-8-15-9-11(17)13(19)14(20)12(18)10-16/h11-20H,2-10H2,1H3
23323-37-7Relevant articles and documents
RESOLUTION OF TETRAHYDROFOLIC ACID DERIVATIVES
-
Page/Page column 25; 26, (2013/03/26)
A process of preparing (6S)-tetrahydrofolic acid derivatives comprising reacting racemic (6RS)-tetrahydrofolic acid derivatives with N-alkyl-D-glucamine, forming N-alkyl-D-glucamine salts of the (6RS)-tetrahydrofolic acid derivatives, isolation of the N-alkyl-D-glucamine salt of the (6S)-tetrahydrofolic acid derivative, removal of the N-alkyl-D-glucamine cation and purification of the (6S)-tetrahydrofolic acid derivative. The purified (6S)-tetrahydrofolic acid derivative can then be converted into the corresponding alkali metal or alkaline earth metal salts.
Process for the resolution of d,1 2-(6-methoxy-2-naphthyl)propionic acid
-
, (2008/06/13)
Mixtures of d 2-(6-methoxy-2-naphthyl)propionic acid and 1 2-(6-methoxy-2-naphthyl)propionic acid or soluble salts thereof are resolved with N-R-D-glucamine or salts thereof, where R is alkyl having 2 to 36 carbon atoms or cycloalkyl having 3 to 8 carbon atoms, to yield a product substantially enriched in d 2-(6-methoxy-2-naphthyl)propionic acid.
