23562-52-9 Usage
General Description
N1-[2-(Acetylamino)-4,5-dichlorophenyl]acetamide is a chemical compound with the molecular formula C10H10Cl2N2O2. It is commonly referred to as dichloroacetamide and is a derivative of acetanilide. N1-[2-(ACETYLAMINO)-4,5-DICHLOROPHENYL]ACETAMIDE is used in the production of various pharmaceuticals and agrochemicals. It is also known for its antibacterial and antifungal properties, making it a valuable ingredient in the development of antimicrobial agents. Additionally, dichloroacetamide has been studied for its potential applications in the treatment of cancer and other diseases. Overall, N1-[2-(Acetylamino)-4,5-dichlorophenyl]acetamide plays a significant role in the fields of medicine and agriculture due to its diverse range of applications and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 23562-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,6 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23562-52:
(7*2)+(6*3)+(5*5)+(4*6)+(3*2)+(2*5)+(1*2)=99
99 % 10 = 9
So 23562-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Cl2N2O2/c1-5(15)13-9-3-7(11)8(12)4-10(9)14-6(2)16/h3-4H,1-2H3,(H,13,15)(H,14,16)
Xi:Irritant;
