23589-06-2 Usage
Description
3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID is a chemical compound with a molecular formula of C14H14O3. It is a derivative of furan and propionic acid, characterized by its white to off-white crystalline powder form and a melting point of 119-121°C. This versatile compound serves as a building block in organic synthesis and is known for its potential in the development of pharmaceuticals, agrochemicals, and novel materials.
Uses
Used in Pharmaceutical Industry:
3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel drugs. Its unique structure allows for the creation of new medicinal compounds with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID is utilized as a precursor in the production of agrochemicals, specifically for the development of new pesticides and other agricultural chemicals. Its chemical properties make it suitable for enhancing crop protection and yield.
Used in Organic Synthesis:
3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID is employed as a building block in organic synthesis, allowing for the creation of a wide range of chemical compounds. Its versatility in forming various molecular structures makes it valuable in research and industrial applications for developing new materials and substances.
Check Digit Verification of cas no
The CAS Registry Mumber 23589-06-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,8 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 23589-06:
(7*2)+(6*3)+(5*5)+(4*8)+(3*9)+(2*0)+(1*6)=122
122 % 10 = 2
So 23589-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H14O3/c1-10-2-4-11(5-3-10)13-8-6-12(17-13)7-9-14(15)16/h2-6,8H,7,9H2,1H3,(H,15,16)
