23747-43-5 Usage
Description
ETHYL 2-(METHYLDITHIO)PROPIONATE, also known as a colorless to pale-yellow liquid, is a chemical compound with the potential for various applications across different industries. Its unique properties make it a versatile substance for a range of uses.
Uses
Used in Chemical Industry:
ETHYL 2-(METHYLDITHIO)PROPIONATE is used as an intermediate for the synthesis of various organic compounds, particularly in the production of pharmaceuticals and agrochemicals. Its ability to form stable bonds with other molecules makes it a valuable component in the development of new products.
Used in Pharmaceutical Industry:
ETHYL 2-(METHYLDITHIO)PROPIONATE is used as a building block for the creation of new drugs, specifically those targeting various diseases and conditions. Its chemical properties allow for the development of innovative medications with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
ETHYL 2-(METHYLDITHIO)PROPIONATE is used as a key component in the formulation of pesticides and other agricultural chemicals. Its role in these products helps to enhance their effectiveness in protecting crops and improving overall agricultural productivity.
Used in Research and Development:
ETHYL 2-(METHYLDITHIO)PROPIONATE is used as a research tool for studying the properties and behavior of various chemical compounds. Its unique characteristics make it an essential substance for advancing scientific knowledge and understanding in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 23747-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,7,4 and 7 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 23747-43:
(7*2)+(6*3)+(5*7)+(4*4)+(3*7)+(2*4)+(1*3)=115
115 % 10 = 5
So 23747-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O2S2/c1-4-8-6(7)5(2)10-9-3/h5H,4H2,1-3H3/t5-/m1/s1
