23969-17-7 Usage
Classification
Belongs to the class of 1,2,4-triazole derivatives
Functional groups
Thione functional group
Mercaptomethyl group attached to the triazole ring
Potential applications
Anti-cancer agent
Antimicrobial properties
Antifungal properties
Inhibition of bacterial and fungal growth
Corrosion inhibition
Ligand in coordination chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 23969-17-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,9,6 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23969-17:
(7*2)+(6*3)+(5*9)+(4*6)+(3*9)+(2*1)+(1*7)=137
137 % 10 = 7
So 23969-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N3S2/c7-1-2-4-3(8)6-5-2/h7H,1H2,(H2,4,5,6,8)