24146-36-9 Usage
Description
(4-Oxo-thiazolidin-2-ylidene)-acetic acid ethyl ester is a chemical compound that is commonly used in pharmaceutical research and drug development. It is an ester derivative of (4-oxo-thiazolidin-2-ylidene)-acetic acid, which is known for its potential anti-inflammatory and antioxidant properties. The ethyl ester form of this compound is often used to improve the solubility and stability of the parent compound, making it easier to formulate for pharmaceutical use.
Used in Pharmaceutical Research and Drug Development:
(4-Oxo-thiazolidin-2-ylidene)-acetic acid ethyl ester is used as a research compound for its potential anti-inflammatory and antioxidant properties. Its ethyl ester form enhances the solubility and stability of the parent compound, making it more suitable for pharmaceutical formulations.
Used in Anti-cancer Applications:
(4-Oxo-thiazolidin-2-ylidene)-acetic acid ethyl ester is being investigated for its potential as an anti-cancer agent due to its ability to induce apoptosis in cancer cells. This property makes it a promising candidate for the development of new cancer therapies.
Overall, (4-Oxo-thiazolidin-2-ylidene)-acetic acid ethyl ester is a versatile compound with promising potential for various therapeutic applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 24146-36-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,1,4 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 24146-36:
(7*2)+(6*4)+(5*1)+(4*4)+(3*6)+(2*3)+(1*6)=89
89 % 10 = 9
So 24146-36-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO3S/c1-2-11-7(10)3-6-8-5(9)4-12-6/h3H,2,4H2,1H3,(H,8,9)/b6-3+
