2425-66-3 Usage
Description
1-Chloro-2-nitropropane is an organic compound that belongs to the chlorinated nitroparaffins family. It is characterized by the presence of a chlorine atom and a nitro group in its propane structure. 1-Chloro-2-nitropropane is known for its versatile applications across different industries due to its unique chemical properties.
Uses
1. Used in the Rubber Industry:
1-Chloro-2-nitropropane is used as a key component in the production of highly accelerated rubber cements. Its presence in the formulation enhances the adhesive properties and bonding strength of the rubber cement, making it suitable for various applications in the rubber industry.
2. Used in the Pesticide Industry:
1-Chloro-2-nitropropane is also utilized in the manufacturing of insecticides. The presence of the chlorine and nitro groups in its structure contributes to its effectiveness as an insecticide, providing a reliable solution for controlling and eliminating pests in agricultural and other settings.
3. Used in Chemical Synthesis:
1-Chloro-2-nitropropane serves as an important intermediate in various chemical synthesis processes. Its unique chemical properties make it a valuable building block for the creation of other complex organic compounds, further expanding its utility in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 2425-66-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,2 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2425-66:
(6*2)+(5*4)+(4*2)+(3*5)+(2*6)+(1*6)=73
73 % 10 = 3
So 2425-66-3 is a valid CAS Registry Number.
InChI:InChI=1/C3H6ClNO2/c1-3(2-4)5(6)7/h3H,2H2,1H3
