2434-56-2 Usage
Description
4,6-Diaminopyrimidine is a chemical compound characterized by its yellow to light yellow crystalline appearance. It is known for its significant role in the preparation of pharmaceutical products, particularly in the development of compounds with potential applications in the medical field.
Uses
Used in Pharmaceutical Industry:
4,6-Diaminopyrimidine is used as a precursor compound for the synthesis of various pharmaceutical goods. Its importance lies in its ability to be transformed into organotin polyamines through a reaction process. These organotin polyamines have demonstrated effective inhibition against two pancreatic cancer cell lines, showcasing their potential as therapeutic agents in the fight against cancer.
Additionally, 4,6-Diaminopyrimidine's role in the pharmaceutical industry extends beyond cancer treatment, as it can be utilized in the development of other medicinal compounds with diverse applications. Its versatility as a building block for pharmaceutical products makes it a valuable asset in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 2434-56-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,3 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2434-56:
(6*2)+(5*4)+(4*3)+(3*4)+(2*5)+(1*6)=72
72 % 10 = 2
So 2434-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4/c5-3-1-4(6)8-2-7-3/h1-2H,(H4,5,6,7,8)
2434-56-2Relevant articles and documents
Cephalosporin antibiotics
-
, (2008/06/13)
The present invention relates to a cephalosporin compound represented by the following general formula (I): STR1 its pharmaceutically acceptable non-toxic salt, physiologically hydrolyzable ester, hydrate or solvate, or isomers thereof, in whichR 1 represents hydrogen or an amino-protecting group,R 2 and R 3 can be identical or different and independently of one another represent hydrogen or a hydroxy-protecting group, orR 2 and R 3 together can form a cyclic diol-protecting group,R 4 represents hydrogen or a carboxyl-protecting group,R 5, R 6 and R 7 independently of one another represent hydrogen, amino or substituted amino, hydroxy, alkoxy, C 1-4 alkyl, carboxyl or alkoxycarbonyl, orR 5 and R 6 together with the carbon atoms to which they are attached can form a C 3-7 cycle, andQ represents CH or N,and to a process for preparation thereof and a pharmaceutical composition containing the compound (I) as an active ingredient.
