24370-73-8 Usage
General Description
5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID is a chemical compound with the molecular formula C20H15NO3. It is a carboxylic acid derivative of indole, containing a benzyl ether group at the 5-position. 5-BENZYLOXY-1H-INDOLE-3-CARBOXYLIC ACID has potential applications in organic synthesis and medicinal chemistry, as indole derivatives have been studied for their biological activities, such as their antibacterial, antifungal, and anticancer properties. The presence of the carboxylic acid group also makes it a valuable intermediate for the synthesis of various pharmaceuticals and bioactive compounds. Additionally, its unique structure and potential reactivity make it an interesting target for further research and development in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 24370-73-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,7 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 24370-73:
(7*2)+(6*4)+(5*3)+(4*7)+(3*0)+(2*7)+(1*3)=98
98 % 10 = 8
So 24370-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO3/c18-16(19)14-9-17-15-7-6-12(8-13(14)15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19)
