244193-56-4 Usage
Description
1-Decyl-3-methylimidazolium tetrafluoroborate, also known as an ionic liquid, is a clear light yellow viscid liquid with unique chemical properties. It is characterized by its ability to form host-guest inclusion complexes and its effectiveness as a solvent in various applications.
Uses
1. Used in Oil and Gas Industry:
1-Decyl-3-methylimidazolium tetrafluoroborate is used as a clathrate hydrate crystal inhibitor in drilling fluid. This application is crucial for preventing the formation of gas hydrates, which can cause blockages and operational issues in the drilling process.
2. Used in Analytical Chemistry:
1-Decyl-3-methylimidazolium tetrafluoroborate is used as a microextraction solvent in the determination of synthetic dyes in foods and cosmetics. Its effectiveness as a solvent allows for the efficient extraction and analysis of dyes, ensuring accurate results in quality control and safety assessments.
3. Used in Host-Guest Inclusion Complexation Studies:
1-Decyl-3-methylimidazolium tetrafluoroborate is used as a substrate in host-guest inclusion complexation studies with β-cyclodextrin. This application is significant for understanding the interactions between the ionic liquid and cyclodextrin, which can lead to the development of new materials and applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 244193-56-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,4,1,9 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 244193-56:
(8*2)+(7*4)+(6*4)+(5*1)+(4*9)+(3*3)+(2*5)+(1*6)=134
134 % 10 = 4
So 244193-56-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H28N2.BF4/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;2-1(3,4)5/h12-13H,3-11,14H2,1-2H3;/q;-1/p+1