2446-07-3 Usage
Description
5-oxo-3-propyl-pyrrolidine-2-carboxylic acid, also known as 3-propylglutaramic acid, is a chemical compound with the molecular formula C8H13NO3. It is a derivative of the amino acid proline and is classified as an N-substituted proline. 5-oxo-3-propyl-pyrrolidine-2-carboxylic acid is commonly used in the field of biochemistry and pharmacology due to its proline-like properties and potential therapeutic applications.
Uses
Used in Biochemistry and Pharmacology:
5-oxo-3-propyl-pyrrolidine-2-carboxylic acid is used as an important intermediate in the synthesis of various biologically active compounds. Its structural variants have been studied for their potential therapeutic applications, making it a valuable compound in the development of new drugs.
Used as a Neurotransmitter Modulator:
5-oxo-3-propyl-pyrrolidine-2-carboxylic acid is used as a neuromodulatory agent for its potential to modulate neurotransmitter release. This property makes it a candidate for the development of treatments targeting neurological disorders.
Used as a Neuroprotective Agent:
In the field of neuroprotection, 5-oxo-3-propyl-pyrrolidine-2-carboxylic acid is used as a potential neuroprotective agent. Its ability to protect neurons from damage or degeneration is of interest for the development of therapies for neurodegenerative diseases.
Used in Anticonvulsant and Anxiolytic Research:
5-oxo-3-propyl-pyrrolidine-2-carboxylic acid is also used in research for its potential anticonvulsant and anxiolytic effects. Its investigation in these areas could lead to the development of new treatments for epilepsy and anxiety disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 2446-07-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,4 and 6 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2446-07:
(6*2)+(5*4)+(4*4)+(3*6)+(2*0)+(1*7)=73
73 % 10 = 3
So 2446-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO3/c1-2-3-5-4-6(10)9-7(5)8(11)12/h5,7H,2-4H2,1H3,(H,9,10)(H,11,12)
