24725-65-3 Usage
General Description
4,5-DICHLORO-2-(2,4-DICHLOROPHENYL)-2,3-DIHYDROPYRIDAZIN-3-ONE is a chemical compound with the molecular formula C11H6Cl4N2O. It is a member of the dihydropyridazine family and is characterized by the presence of two chlorine atoms on the 4th and 5th positions of the phenyl ring. It is a yellow crystalline solid that is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. 4,5-DICHLORO-2-(2,4-DICHLOROPHENYL)-2,3-DIHYDROPYRIDAZIN-3-ONE is also known for its potential biological activities, including anti-tumor and antibacterial properties, making it a subject of interest in medicinal chemistry and drug development. Its unique molecular structure and chemical reactivity make it a valuable tool in the field of organic synthesis and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 24725-65-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,7,2 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 24725-65:
(7*2)+(6*4)+(5*7)+(4*2)+(3*5)+(2*6)+(1*5)=113
113 % 10 = 3
So 24725-65-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H4Cl4N2O/c11-5-1-2-8(6(12)3-5)16-10(17)9(14)7(13)4-15-16/h1-4H