251101-36-7 Usage
General Description
3-Methyl-Pyridine-4-Carboxamide is a chemical compound commonly recognized by its systematic name, 4-carbamoyl-3-methylpyridine. It falls under the category of Pyridines and derivatives. This chemical is not well-known outside the scientific community, due to its specific use in the pharma or chemical industry. As a chemical, it is likely to be involved as an intermediate or reagent in various chemical reactions during the manufacturing of pharmaceuticals or other organic products. However, specific properties such as color, odor, solubility, or boiling and melting points would depend on its physical state and purity. The safety and toxicity of this compound have not been fully established, and proper care should be taken while handling it.
Check Digit Verification of cas no
The CAS Registry Mumber 251101-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,1,1,0 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 251101-36:
(8*2)+(7*5)+(6*1)+(5*1)+(4*0)+(3*1)+(2*3)+(1*6)=77
77 % 10 = 7
So 251101-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-5-4-9-3-2-6(5)7(8)10/h2-4H,1H3,(H2,8,10)
