25189-55-3 Usage
Description
Poly(N-isopropylacrylamide) (PNIPAM) is a temperature-responsive polymer derived from the polymerization of N-isopropylamide. It is known for its reversible, lower critical solution temperature (LCST) phase transition at around 32 °C, where it transitions from a soluble to an insoluble state. PNIPAM is also characterized by its narrow distribution of chain lengths, which contributes to better reproducibility. This polymer is widely used in biomedical research applications, including tissue engineering and controlled drug delivery, due to its similarity in temperature with the human body.
Uses
Used in Biomedical Research:
Poly(N-isopropyl acrylamide) is used as a temperature-responsive polymer for the development of thermosensitive coated micro/nano materials. Its phase transition at 32 °C makes it suitable for applications in biomedical research, particularly in the field of tissue engineering and controlled drug delivery.
Used in Drug Delivery Systems:
PNIPAM is used as a thermoresponsive polymeric drug delivery system. The carboxylic acid functional group present in the polymer allows for the conjugation of various biomolecules to the polymer chain, enhancing its potential in targeted drug delivery and improving therapeutic outcomes.
Used in Hydrogel Formation:
Poly(N-isopropyl acrylamide) is used as a hydrogel-forming material. Its aqueous polymer solution undergoes a phase transition from a soluble to an insoluble state when the temperature is raised to approximately 32 °C. This property makes PNIPAM hydrogels ideal for various applications, including tissue engineering and controlled release of bioactive molecules.
Used in Amphiphilic Block Copolymers:
PNIPAM is used as the hydrophilic block in the synthesis of thermoresponsive, amphiphilic block copolymers. These copolymers have potential applications in the development of novel materials with tunable properties for various industries, such as pharmaceuticals, biotechnology, and materials science.
Used in Coatings and Materials Science:
Poly(N-isopropyl acrylamide) is used as a component in the development of thermosensitive coatings and materials. Its temperature-responsive nature allows for the creation of materials with tunable properties, making it suitable for various applications in different industries, such as electronics, sensors, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 25189-55-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,1,8 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 25189-55:
(7*2)+(6*5)+(5*1)+(4*8)+(3*9)+(2*5)+(1*5)=123
123 % 10 = 3
So 25189-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO/c1-3-5-7-6(8)4-2/h4H,2-3,5H2,1H3,(H,7,8)