25665-01-4 Usage
Description
[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile is a complex organic compound with the molecular formula C20H23N3O2. It is characterized by its yellow to brown solid appearance and is known for its fluorescent properties, making it a versatile chemical with various applications in scientific and industrial fields. [[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile serves as a fluorescent dye, a pH indicator, a chemical intermediate, and a component in organic synthesis. Its effectiveness as a fluorescence resonance energy transfer (FRET) donor highlights its potential in bioimaging and biosensors, while its light-absorbing properties have been investigated for use in photodynamic therapy for cancer treatment. However, due to its potential hazardous properties, careful handling is required.
Uses
Used in Fluorescent Dyes:
[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile is used as a fluorescent dye for its ability to emit light when excited by a specific wavelength, making it useful in various analytical techniques and imaging processes.
Used in pH Indicators:
[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile is utilized as a pH indicator due to its color-changing properties in response to different pH levels, which is valuable in chemical and biological research as well as in educational settings.
Used as a Chemical Intermediate:
In the chemical industry, [[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile serves as an intermediate in the synthesis of more complex molecules, contributing to the development of new materials and pharmaceuticals.
Used in Organic Synthesis:
It is employed in organic synthesis for the creation of a variety of organic compounds, showcasing its versatility in chemical reactions and its role in advancing chemical research.
Used in Bioimaging and Biosensors:
As a FRET donor, [[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methylene]malononitrile is used in bioimaging to visualize biological processes and structures with high specificity and sensitivity. It is also utilized in the development of biosensors for detecting biological molecules or environmental changes.
Used in Photodynamic Therapy for Cancer Treatment:
Its light-absorbing properties have led to studies on its potential use in photodynamic therapy, where it could be activated by light to generate reactive oxygen species, thereby targeting and destroying cancer cells.
Used in Research and Development:
In the scientific community, this compound is used in research and development for exploring new applications and understanding its chemical behavior, which could lead to innovative uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 25665-01-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,6 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25665-01:
(7*2)+(6*5)+(5*6)+(4*6)+(3*5)+(2*0)+(1*1)=114
114 % 10 = 4
So 25665-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H17N3O2/c1-12-8-15(18(4-6-19)5-7-20)3-2-14(12)9-13(10-16)11-17/h2-3,8-9,19-20H,4-7H2,1H3
