26007-43-2 Usage
General Description
"Bicyclo2.2.1hept-2-ene, polymer with ethene" is a chemical compound that is a polymer consisting of repeating units of bicyclo2.2.1hept-2-ene and ethene. Bicyclo2.2.1hept-2-ene is a bicyclic compound with a seven-membered ring, while ethene is a simple molecule containing a carbon-carbon double bond. When these two compounds undergo polymerization, they form a long chain of repeating units, resulting in a polymer with unique properties. This polymer may have applications in various industries, such as in the production of plastics, coatings, adhesives, or other materials. The specific properties and uses of this polymer would depend on the processing and formulation of the material.
Check Digit Verification of cas no
The CAS Registry Mumber 26007-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,0 and 7 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 26007-43:
(7*2)+(6*6)+(5*0)+(4*0)+(3*7)+(2*4)+(1*3)=82
82 % 10 = 2
So 26007-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10.C2H4/c1-2-7-4-3-6(1)5-7;1-2/h1-2,6-7H,3-5H2;1-2H2
