26028-64-8 Usage
General Description
The chemical 5-(3-chlorophenyl)-4-isobutyl-4H-1,2,4-triazole-3-thiol is a compound with the molecular formula C13H15ClN4S. It is a triazole-thiol derivative, which is a class of organic compounds that are commonly used in pharmaceuticals, agriculture, and materials science. This particular compound contains a triazole ring, a thiol group, and a chlorophenyl substituent, which gives it unique chemical properties and potential applications. Triazole-thiol compounds have been studied for their antimicrobial, antifungal, and anticancer properties, and are also used as building blocks for the synthesis of other bioactive molecules. Further research into the properties and potential uses of 5-(3-chlorophenyl)-4-isobutyl-4H-1,2,4-triazole-3-thiol could reveal its potential as a valuable compound in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 26028-64-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,2 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 26028-64:
(7*2)+(6*6)+(5*0)+(4*2)+(3*8)+(2*6)+(1*4)=98
98 % 10 = 8
So 26028-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H14ClN3S/c1-8(2)7-16-11(14-15-12(16)17)9-4-3-5-10(13)6-9/h3-6,8H,7H2,1-2H3,(H,15,17)
