2613-69-6 Usage
Description
(1α,2α,3α)-1,2,3-Trimethylcyclopentane is an organic compound characterized by its unique molecular structure, featuring three methyl groups attached to the cyclopentane ring in specific positions (1α, 2α, and 3α). (1α,2α,3α)-1,2,3-Trimethylcyclopentane is known for its distinct chemical properties and potential applications in various industries.
Uses
Used in Food-Contact Materials:
(1α,2α,3α)-1,2,3-Trimethylcyclopentane is used as a volatile compound in the production of acrylic-base adhesives for food-contact materials. Its application is due to its ability to migrate from the adhesive into the food-contact materials, contributing to the overall composition and properties of the adhesive.
Check Digit Verification of cas no
The CAS Registry Mumber 2613-69-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,1 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2613-69:
(6*2)+(5*6)+(4*1)+(3*3)+(2*6)+(1*9)=76
76 % 10 = 6
So 2613-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7+,8-
