26166-37-0 Usage
Description
Denudatine, an alkaloid derived from the leaves of certain Mongolian Ranunculaceae species, is a bioactive compound with notable anti-fungal properties. Its chemical structure allows it to interact with specific cellular targets, making it a potential candidate for various pharmaceutical and industrial applications.
Uses
Used in Pharmaceutical Industry:
Denudatine is used as an anti-fungal agent for its ability to inhibit the growth and proliferation of various fungi. This property makes it a valuable component in the development of medications aimed at treating fungal infections.
Used in Agricultural Industry:
In agriculture, denudatine can be utilized as a natural fungicide to protect crops from fungal diseases, thereby reducing the reliance on synthetic chemical fungicides and promoting sustainable farming practices.
Used in Cosmetics Industry:
Due to its anti-fungal activity, denudatine can also be employed in the cosmetics industry as an additive in personal care products to prevent fungal contamination and maintain product integrity.
Used in Research and Development:
Denudatine's anti-fungal properties make it a valuable compound for research purposes, particularly in the development of new anti-fungal drugs and understanding the mechanisms behind its action against fungi.
Check Digit Verification of cas no
The CAS Registry Mumber 26166-37-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,1,6 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26166-37:
(7*2)+(6*6)+(5*1)+(4*6)+(3*6)+(2*3)+(1*7)=110
110 % 10 = 0
So 26166-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H33NO2/c1-4-23-11-20(3)7-5-8-22-15(20)10-14(18(22)23)21-9-6-13(12(2)19(21)25)16(24)17(21)22/h13-19,24-25H,2,4-11H2,1,3H3/t13-,14?,15-,16+,17-,18-,19-,20+,21+,22+/m1/s1