26446-32-2 Usage
Description
Glycerol 5-hydroxydodecanoate, also known as Glyceryd 5-hydroxydodecanoate, is a chemical compound derived from glycerol and 5-hydroxydodecanoic acid. It possesses a mild, fatty odor and is known for its unique chemical properties that make it suitable for various applications.
Uses
Used in Adhesive Industry:
Glycerol 5-hydroxydodecanoate is used as a flame-retardant antimicrobial polyurethane glass adhesive. Its flame-retardant properties make it an ideal component for creating adhesives that can withstand high temperatures and resist ignition, ensuring safety and durability in various applications.
Used in Antimicrobial Applications:
Glycerol 5-hydroxydodecanoate is also used for its antimicrobial properties, making it suitable for use in products that require protection against microbial growth. This can be particularly useful in industries such as healthcare, food packaging, and water treatment, where preventing the spread of bacteria and other microorganisms is crucial.
Used in Cosmetics and Personal Care Industry:
Due to its mild, fatty odor and unique chemical properties, Glycerol 5-hydroxydodecanoate can be used as an ingredient in cosmetics and personal care products. It can be incorporated into formulations for moisturizers, creams, and lotions, providing a pleasant scent and enhancing the product's performance.
Used in Pharmaceutical Industry:
Glycerol 5-hydroxydodecanoate can also be utilized in the pharmaceutical industry for various applications, such as drug delivery systems or as an excipient in the formulation of medications. Its unique properties may contribute to improved drug stability, solubility, or bioavailability.
Check Digit Verification of cas no
The CAS Registry Mumber 26446-32-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,4 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 26446-32:
(7*2)+(6*6)+(5*4)+(4*4)+(3*6)+(2*3)+(1*2)=112
112 % 10 = 2
So 26446-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H30O5/c1-2-3-4-5-6-8-13(18)9-7-10-15(19)20-14(11-16)12-17/h13-14,16-18H,2-12H2,1H3
