26486-21-5 Usage
Description
2,5-DIMETHYL-3-TETRAHYDROFURANTHIOL,CISANDTRANSISOMERS is a chemical compound with a distinct aroma reminiscent of roasted meat and sulfurous onion. It is characterized by its cis and trans isomers, which contribute to its unique properties and potential applications.
Uses
Used in Flavor and Fragrance Industry:
2,5-DIMETHYL-3-TETRAHYDROFURANTHIOL,CISANDTRANSISOMERS is used as a flavoring agent for its roasted meat and sulfurous onion aroma, adding depth and complexity to various food products.
Used in Perfumery:
In the perfumery industry, 2,5-DIMETHYL-3-TETRAHYDROFURANTHIOL,CISANDTRANSISOMERS is used as a fragrance ingredient to provide a unique and natural scent to perfumes and other scented products.
Used in Chemical Research:
2,5-DIMETHYL-3-TETRAHYDROFURANTHIOL,CISANDTRANSISOMERS can be utilized in chemical research and development, particularly in the study of sulfur-containing compounds and their potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 26486-21-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,8 and 6 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 26486-21:
(7*2)+(6*6)+(5*4)+(4*8)+(3*6)+(2*2)+(1*1)=125
125 % 10 = 5
So 26486-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H12OS/c1-4-3-6(8)5(2)7-4/h4-6,8H,3H2,1-2H3
26486-21-5Relevant articles and documents
Certain lower alkyl 4,5-dihydrothiophene-3-thiols
-
, (2008/06/13)
Novel sulphur containing food flavor substances are provided containing an oxygen or sulphur atom in a five or six membered ring structure, one alkyl or hydroxy alkyl substituent at at least either of the carbon atoms adjacent to the hetero atom and having at least one sulphur or oxygen atom attached to another carbon atom of the ring structure.
