26639-29-2 Usage
Chemical class
Naphthamides
A group of chemical compounds that includes 1-Hydroxy-N-octadecyl-N-(3,5-dicarboxy-phenyl)-2-naphthamide.
Molecular structure
Long-chain fatty acid amide derivative
Consisting of an 18-carbon octadecyl chain, a hydroxy group, a dicarboxy-phenyl group, and a naphthamide moiety.
Hydroxy group
-OH
A polar functional group that contributes to the compound's hydrophilic properties and can form hydrogen bonds with water molecules.
Dialcarboxy-phenyl group
two -COOH groups attached to a benzene ring
Two carboxylic acid groups (-COOH) attached to a phenyl ring, which provide the compound with acidic properties and contribute to its solubility in polar solvents.
Naphthamide moiety
a naphthalene ring with an amide group (-CONH2)
A naphthalene ring structure with an amide group attached, which contributes to the compound's stability and potential applications in various industries.
Potential applications
Surfactant, emulsifier, or dispersant
Due to its unique structure and properties, 1-Hydroxy-N-octadecyl-N-(3,5-dicarboxy-phenyl)-2-naphthamide can be used as a surfactant, emulsifier, or dispersant in cosmetic and personal care products.
Industrial and research fields
Various applications
The compound's unique structure and properties make it a promising candidate for further studies and potential commercial uses in different sectors, such as pharmaceuticals, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 26639-29-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,3 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 26639-29:
(7*2)+(6*6)+(5*6)+(4*3)+(3*9)+(2*2)+(1*9)=132
132 % 10 = 2
So 26639-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C37H49NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24-38(31-26-29(36(41)42)25-30(27-31)37(43)44)35(40)33-23-22-28-20-17-18-21-32(28)34(33)39/h17-18,20-23,25-27,39H,2-16,19,24H2,1H3,(H,41,42)(H,43,44)