269726-84-3 Usage
General Description
FMOC-(R)-3-AMINO-4-(3-CYANO-PHENYL)-BUTYRIC ACID is a chemical compound with the molecular formula C24H20N2O4. It is a derivative of the amino acid 3-amino-4-(3-cyano-phenyl)-butyric acid and is commonly used in peptide synthesis and pharmaceutical research. The compound is often used as a building block for the creation of peptide-based drugs and has applications in the development of new pharmaceutical compounds. The FMOC group attached to the amino acid residue makes it suitable for solid-phase peptide synthesis, allowing for the creation of complex peptide structures. FMOC-(R)-3-AMINO-4-(3-CYANO-PHENYL)-BUTYRIC ACID is important in the field of medicinal chemistry and drug discovery, playing a role in the development of potential drug candidates for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 269726-84-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,7,2 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 269726-84:
(8*2)+(7*6)+(6*9)+(5*7)+(4*2)+(3*6)+(2*8)+(1*4)=193
193 % 10 = 3
So 269726-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C26H22N2O4/c27-15-18-7-5-6-17(12-18)13-19(14-25(29)30)28-26(31)32-16-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-12,19,24H,13-14,16H2,(H,28,31)(H,29,30)/t19-/m1/s1