270062-83-4 Usage
General Description
FMOC-(S)-3-AMINO-4-(4-FLUORO-PHENYL)-BUTYRIC ACID is a chemical compound used in organic synthesis and pharmaceutical research. The compound is derived from the amino acid alanine, with an added fluorine-substituted phenyl group. It is often used as a building block in the synthesis of peptide-based drugs and pharmaceuticals due to its potential pharmacological properties. The FMOC protecting group allows for selective deprotection and functionalization of the amino group, making it a useful tool for customizing peptide structures. FMOC-(S)-3-AMINO-4-(4-FLUORO-PHENYL)-BUTYRIC ACID has potential applications in drug discovery and development due to its structural versatility and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 270062-83-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 270062-83:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*2)+(2*8)+(1*3)=114
114 % 10 = 4
So 270062-83-4 is a valid CAS Registry Number.
InChI:InChI=1/C25H22FNO4/c26-17-11-9-16(10-12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m0/s1