270063-46-2 Usage
General Description
Fmoc-(S)-3-Amino-4-(3-benzothienyl)-butyric acid is a chemical compound used in the field of organic chemistry for the synthesis of peptides and other complex molecules. It consists of a butyric acid molecule with an amino group and a benzothienyl group attached to it, along with the Fmoc protecting group. Fmoc-(S)-3-Amino-4-(3-benzothienyl)-butyric acid is often utilized as a building block in the solid-phase synthesis of peptides due to its ability to facilitate the controlled formation of peptide bonds. Additionally, its stereochemistry and unique structural characteristics make it valuable for the creation of diverse peptide sequences with specific functionalities, making it an important tool in the development of pharmaceuticals and bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 270063-46-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 3 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 270063-46:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*3)+(2*4)+(1*6)=112
112 % 10 = 2
So 270063-46-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H23NO4S/c29-26(30)14-18(13-17-16-33-25-12-6-5-7-19(17)25)28-27(31)32-15-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-12,16,18,24H,13-15H2,(H,28,31)(H,29,30)/t18-/m0/s1