270065-90-2 Usage
General Description
Fmoc-(S)-3-Amino-4-(4-cyano-phenyl)-butyric acid is a complex organic compound often used within the field of biochemistry, particularly in peptide synthesis. It falls under the subdivision of unusual amino acids, due to its structural modifications that set it apart from the 20 standard amino acids typically involved in the formation of proteins. This molecule incorporates a fluorophore group, which serves crucial purposes such as identification and tracking during biochemical reactions. The cyano-phenyl group this compound possesses makes it useful in applications requiring significant fluorescence. It's often utilized due to its inherent properties that allow it to interact with light and generate specific and identifiable signals, making it a hugely important tool in numerous scientific studies.
Check Digit Verification of cas no
The CAS Registry Mumber 270065-90-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 270065-90:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*5)+(2*9)+(1*0)=122
122 % 10 = 2
So 270065-90-2 is a valid CAS Registry Number.
InChI:InChI=1/C26H22N2O4/c27-15-18-11-9-17(10-12-18)13-19(14-25(29)30)28-26(31)32-16-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-12,19,24H,13-14,16H2,(H,28,31)(H,29,30)/t19-/m0/s1