27058-54-4 Usage
General Description
5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo- (8CI,9CI) is a chemical compound with the molecular formula C7H6N4O. It is a heterocyclic compound containing a pyrimidine ring with a cyano group attached at position 5. 5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo- (8CI,9CI) is also known as 2-methyl-4-oxo-1,4-dihydropyrimidine-5-carbonitrile and is a building block for the synthesis of various pharmaceuticals and agrochemicals. It has potential applications in the fields of medicinal chemistry and drug discovery, and its properties and reactivity make it a useful intermediate for the production of diverse chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 27058-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,5 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 27058-54:
(7*2)+(6*7)+(5*0)+(4*5)+(3*8)+(2*5)+(1*4)=114
114 % 10 = 4
So 27058-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3O/c1-4-8-3-5(2-7)6(10)9-4/h3H,1H3,(H,8,9,10)