27421-51-8 Usage
Description
1-METHYLINDOLE-2-CARBOXALDEHYDE 97, also known as 1-Methylindole-2-carboxaldehyde, is an organic compound with the molecular formula C10H9NO. It is a derivative of indole, featuring a methyl group and a formyl group attached to the indole structure. 1-METHYLINDOLE-2-CARBOXALDEHYDE 97 is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
1-METHYLINDOLE-2-CARBOXALDEHYDE 97 is used as a reactant for the preparation of various pharmaceutical compounds, including:
1. Deazapurine isosteres from acylindoles via pyridine ring annulation: These compounds are synthesized for their potential applications in the development of novel therapeutic agents.
2. 2,4-dichlorocinnamohydroxamic acid analogs: These analogs are designed to enhance the pharmacokinetics of botulinum neurotoxin serotype A protease inhibitors, which can be beneficial in the treatment of various neurological disorders.
3. Tetrahydrocarbazoles: Synthesized via organocatalytic cascade Friedel-Crafts alkylation/Michael addition/aromatization reaction, these compounds have potential applications in the development of new drugs.
4. Azides, imines, and amines: Produced via flow processes of amines and trimethylsilyl azide and aza-Wittig reaction, these compounds are used in the synthesis of various pharmaceutical agents.
5. 3-indolylpyridinedicarbonitriles: These compounds are synthesized as potential anti-inflammatory agents, which can be used in the development of new treatments for inflammation-related conditions.
6. Bis(indolyl)methanes: These compounds are synthesized for their antimicrobial and antioxidant properties, which can be utilized in the development of new drugs for infectious diseases and oxidative stress-related conditions.
Used in Chemical Industry:
1-METHYLINDOLE-2-CARBOXALDEHYDE 97 is also used as a building block and intermediate in the synthesis of various organic compounds, which can be applied in different industries such as materials science, agrochemicals, and dyes. Its unique structural properties make it a versatile compound for the development of new molecules with specific functionalities.
Check Digit Verification of cas no
The CAS Registry Mumber 27421-51-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,2 and 1 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 27421-51:
(7*2)+(6*7)+(5*4)+(4*2)+(3*1)+(2*5)+(1*1)=98
98 % 10 = 8
So 27421-51-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO/c1-11-9(7-12)6-8-4-2-3-5-10(8)11/h2-7H,1H3
27421-51-8Relevant articles and documents
Generation and Intermolecular Reactions of 2-Indolylacyl Radicals
Bennasar, M.-Lluisa,Roca, Tomas,Griera, Rosa,Bosch, Joan
, p. 1697 - 1700 (2007/10/03)
(matrix presented) The generation of 2-indolylacyl radicals from the corresponding phenyl selenoesters, aldehydes, and α-keto carboxylic acids and the scope of their participation in intermolecular addition reactions to carbon-carbon double bonds have bee
