27482-50-4 Usage
General Description
3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] is a complex chemical compound that is a cyclopeptide, meaning it is a cyclic peptide consisting of multiple amino acid residues. It is composed of the amino acids D-Lac, L-Pro, L-Ile, N-methyl-L-Val, N-methyl-L-Ala, and βAla, and also contains a carboxyethyl group. 3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] has potential applications in the fields of pharmaceuticals, biochemistry, and drug development due to its unique structure and properties. Its specific chemical structure gives it the potential to interact with biological systems in unique ways, making it an interesting area for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 27482-50-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,8 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27482-50:
(7*2)+(6*7)+(5*4)+(4*8)+(3*2)+(2*5)+(1*0)=124
124 % 10 = 4
So 27482-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C30H49N5O9/c1-9-17(4)23-28(40)34(8)24(16(2)3)29(41)33(7)19(6)25(37)31-13-12-22(36)44-21(15-18(5)30(42)43)27(39)35-14-10-11-20(35)26(38)32-23/h16-21,23-24H,9-15H2,1-8H3,(H,31,37)(H,32,38)(H,42,43)