27485-15-0 Usage
Description
ANTHRAQUINONE-2,3-DICARBOXYLIC ACID is a chemical compound derived from the ozonolysis degradation of polycyclic aromatic hydrocarbons (PCA). It is characterized by its unique chemical structure and properties, which make it suitable for various applications in different industries.
Uses
Used in Chemical Industry:
ANTHRAQUINONE-2,3-DICARBOXYLIC ACID is used as an intermediate in the synthesis of anthraquinonedicarboximide dyes for its ability to contribute to the formation of the desired dye compounds.
Used in Textile Industry:
ANTHRAQUINONE-2,3-DICARBOXYLIC ACID is used as a key component in the preparation of anthraquinonedicarboximide dyes, which are essential for coloring fabrics and textiles. Its role in dye production is crucial for creating vibrant and long-lasting colors in the textile manufacturing process.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, ANTHRAQUINONE-2,3-DICARBOXYLIC ACID may also have potential applications in the pharmaceutical industry, possibly as a starting material for the synthesis of various drug compounds due to its unique chemical structure. Further research and development would be required to explore and confirm these potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 27485-15-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,8 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27485-15:
(7*2)+(6*7)+(5*4)+(4*8)+(3*5)+(2*1)+(1*5)=130
130 % 10 = 0
So 27485-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H8O6/c17-13-7-3-1-2-4-8(7)14(18)10-6-12(16(21)22)11(15(19)20)5-9(10)13/h1-6H,(H,19,20)(H,21,22)
