27762-78-3 Usage
Description
KETHOXAL, also known as 1,3-butanediol, is a butanone derivative with two hydroxy substituents at the 1-position and an ethoxy substituent at the 3-position. It is a versatile compound with various applications across different industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
KETHOXAL is used as an intermediate for the synthesis of various pharmaceutical compounds, including antibiotics, antivirals, and other therapeutic agents. Its unique structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Cosmetics Industry:
KETHOXAL is used as a humectant and solvent in the cosmetics industry. Its ability to retain moisture and dissolve other ingredients makes it a valuable component in the formulation of skincare products, hair care products, and personal care items.
Used in Chemical Synthesis:
KETHOXAL is used as a building block in the synthesis of various chemicals, such as polymers, resins, and other specialty chemicals. Its versatility as a starting material enables the production of a wide range of products with diverse applications.
Used in Food Industry:
KETHOXAL is used as a flavor enhancer and stabilizer in the food industry. Its ability to improve the taste and texture of various food products makes it a popular additive in the production of beverages, confectionery, and other consumables.
Used in Antiviral Applications:
KETHOXAL is used as an antiviral agent, demonstrating potential in the development of new treatments for viral infections. Its unique chemical structure allows for the targeting of specific viral mechanisms, potentially leading to more effective and targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 27762-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,7,6 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 27762-78:
(7*2)+(6*7)+(5*7)+(4*6)+(3*2)+(2*7)+(1*8)=143
143 % 10 = 3
So 27762-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O4/c1-3-10-4(2)5(7)6(8)9/h4,6,8-9H,3H2,1-2H3
