2831-75-6 Usage
Description
Daurinoline is a natural alkaloid derived from various plant sources, known for its potent anti-cancer properties. It functions as a DNA G-quadruplex stabilizer, effectively inhibiting the proliferation of tumor cells and showcasing significant potential in the field of oncology.
Uses
Used in Anticancer Applications:
Daurinoline is utilized as an anti-cancer agent, particularly effective against a wide range of solid malignancies. It acts as a DNA G-quadruplex stabilizer, disrupting the normal functioning of cancer cells and halting their proliferation. This unique mechanism of action makes Daurinoline a promising candidate for the development of novel cancer therapeutics.
Additionally, Daurinoline demonstrates the potential for synergistic effects when combined with conventional chemotherapeutic drugs, potentially enhancing their efficacy and overcoming resistance in difficult-to-treat cancer cases.
Used in Pharmaceutical Research and Development:
In the pharmaceutical industry, Daurinoline is employed as a key compound in the research and development of innovative cancer treatments. Its unique mode of action as a DNA G-quadruplex stabilizer offers new avenues for targeted cancer therapies, and ongoing research aims to optimize its potential for clinical use.
Furthermore, Daurinoline's properties are being explored for integration into drug delivery systems, with the goal of improving its bioavailability, targeting specific cancer cells, and enhancing overall therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 2831-75-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,3 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2831-75:
(6*2)+(5*8)+(4*3)+(3*1)+(2*7)+(1*5)=86
86 % 10 = 6
So 2831-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C37H42N2O6/c1-38-14-12-25-19-33(41)34(42-3)21-28(25)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-29-22-37(44-5)36(43-4)20-26(29)13-15-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1