28360-49-8 Usage
Description
MAHANINE is a terpene alkaloid found in the leaves of Murraya koenigii Spreng. It is a laevorotatory compound with a specific rotation of [α]D 24.4°. The molecular structure of MAHANINE consists of two methyl groups, one phenolic hydroxyl, an imino group, and an unsaturated side chain. This unique composition endows MAHANINE with various potential applications in different industries.
Uses
Used in Pharmaceutical Industry:
MAHANINE is used as a bioactive compound for its potential therapeutic properties. The presence of various functional groups in its structure allows it to interact with biological targets, making it a promising candidate for the development of new drugs and treatments.
Used in Chemical Research:
MAHANINE serves as a valuable compound in chemical research, particularly in the study of terpene alkaloids and their potential applications. Its unique structure and properties can provide insights into the development of new synthetic methods and the exploration of novel chemical reactions.
Used in Natural Product Chemistry:
As a naturally occurring compound, MAHANINE is used in the field of natural product chemistry to study the biosynthesis, isolation, and structural elucidation of similar alkaloids. This research can lead to the discovery of new bioactive compounds with potential applications in various industries.
Used in Drug Delivery Systems:
Similar to gallotannin, MAHANINE can be employed in drug delivery systems to enhance its bioavailability and therapeutic outcomes. By incorporating MAHANINE into various carriers, such as organic and metallic nanoparticles, its delivery and efficacy can be improved, potentially leading to better treatment options for various diseases and conditions.
References
Narasimhan, Paradkar, Kelkar.,lnd. J. Chem., 8,473 (1970)
Check Digit Verification of cas no
The CAS Registry Mumber 28360-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,6 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28360-49:
(7*2)+(6*8)+(5*3)+(4*6)+(3*0)+(2*4)+(1*9)=118
118 % 10 = 8
So 28360-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H25NO2/c1-14(2)6-5-10-23(4)11-9-18-21-19(12-15(3)22(18)26-23)17-8-7-16(25)13-20(17)24-21/h6-9,11-13,24-25H,5,10H2,1-4H3/t23-/m1/s1