2847-30-5 Usage
Description
2-Methoxy-3-methylpyrazine is an organic compound with the chemical formula C6H8N2O. It is a clear, colorless liquid that has been evaluated for its effects on the hamster oviduct, specifically on ciliary beat frequency, oocyte pickup rate, and infundibular smooth muscle contraction.
Uses
Used in Pharmaceutical Industry:
2-Methoxy-3-methylpyrazine is used as a research compound for studying its effects on the reproductive system, particularly in the hamster oviduct. Its application in this field is due to its ability to inhibit ciliary beat frequency, oocyte pickup rate, and infundibular smooth muscle contraction, which can provide valuable insights into reproductive biology and potential therapeutic targets for fertility issues.
Used in Chemical Research:
As a clear, colorless liquid with specific chemical properties, 2-Methoxy-3-methylpyrazine can be used as a starting material or intermediate in the synthesis of various chemical compounds. Its application in this field is due to its unique molecular structure, which can be further modified or reacted with other molecules to create new compounds with different properties and potential applications.
Used in Flavor and Fragrance Industry:
2-Methoxy-3-methylpyrazine may also find use in the flavor and fragrance industry due to its potential to contribute specific olfactory properties when used in the creation of various scents and flavors. Its application in this field is based on the compound's ability to mimic or enhance natural aromas, providing a unique sensory experience in various products.
Please note that the specific uses mentioned above are inferred from the provided materials and general knowledge of similar compounds. Further research and development may be required to fully understand and optimize the applications of 2-Methoxy-3-methylpyrazine in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2847-30-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,4 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2847-30:
(6*2)+(5*8)+(4*4)+(3*7)+(2*3)+(1*0)=95
95 % 10 = 5
So 2847-30-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-5-6(9-2)8-4-3-7-5/h3-4H,1-2H3
