28599-72-6 Usage
Description
4-ADAMANTAN-1-YLMETHYL-THIAZOL-2-YLAMINE is a chemical compound characterized by its molecular formula C15H24N2S. It is a thiazole derivative featuring an adamantyl group attached to the thiazole ring, which endows it with unique structural features. 4-ADAMANTAN-1-YLMETHYL-THIAZOL-2-YLAMINE holds potential for pharmaceutical applications, making it a promising candidate for the development of new drugs or as a building block in the synthesis of other organic compounds. Further research and testing in medicinal chemistry are required to explore its specific properties and potential uses.
Uses
Used in Pharmaceutical Industry:
4-ADAMANTAN-1-YLMETHYL-THIAZOL-2-YLAMINE is used as a potential pharmaceutical compound for its unique structural features, which may contribute to the development of new drugs. Its specific application in drug development would be determined by ongoing research and testing, focusing on its potential therapeutic effects and mechanisms of action.
Used in Organic Synthesis:
In the field of organic chemistry, 4-ADAMANTAN-1-YLMETHYL-THIAZOL-2-YLAMINE serves as a building block for the synthesis of other organic compounds. Its unique adamantyl-thiazole structure can be utilized in the creation of novel molecules with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals. 4-ADAMANTAN-1-YLMETHYL-THIAZOL-2-YLAMINE's role in organic synthesis would be to provide a structural foundation for the development of new and innovative chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 28599-72-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,5,9 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 28599-72:
(7*2)+(6*8)+(5*5)+(4*9)+(3*9)+(2*7)+(1*2)=166
166 % 10 = 6
So 28599-72-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2S/c15-13-16-12(8-17-13)7-14-4-9-1-10(5-14)3-11(2-9)6-14/h8-11H,1-7H2,(H2,15,16)