2905-86-4 Usage
Description
3-(carbamoylamino)-2-methyl-propanoic acid is a ureidocarboxylic acid derivative, specifically a 2-methylpropanoic acid molecule that has a carbamoylamino group substituted at the 3rd position. 3-(carbamoylamino)-2-methyl-propanoic acid is characterized by its unique structural features, which may potentially offer a range of applications across different industries.
Uses
Used in Pharmaceutical Industry:
3-(carbamoylamino)-2-methyl-propanoic acid is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, such as those targeting specific enzymes or receptors in the body.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-(carbamoylamino)-2-methyl-propanoic acid serves as an important intermediate for the production of a wide range of chemical products. Its versatile structure enables it to be a key component in the synthesis of various organic compounds, including those with potential applications in materials science, agriculture, and other industries.
Used in Research and Development:
3-(carbamoylamino)-2-methyl-propanoic acid is utilized as a research compound in academic and industrial laboratories. Its unique properties make it an interesting subject for studying various chemical reactions and exploring its potential applications in different fields, such as drug discovery, material science, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 2905-86-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,0 and 5 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2905-86:
(6*2)+(5*9)+(4*0)+(3*5)+(2*8)+(1*6)=94
94 % 10 = 4
So 2905-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10)
