29096-93-3 Usage
Description
2,5-Dibromo-3-isopropyl-6-methylbenzoquinone is an organic compound characterized by its quinone structure, which features two bromine atoms at the 2nd and 5th positions, an isopropyl group at the 3rd position, and a methyl group at the 6th position. 2,5-Dibromo-3-isopropyl-6-methylbenzoquinone is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
2,5-Dibromo-3-isopropyl-6-methylbenzoquinone is used as an inhibitor for respiratory and photosynthetic processes, making it a valuable compound for research and development in the pharmaceutical sector. Its ability to inhibit these processes can be utilized in the creation of new drugs targeting specific diseases and conditions.
Used in Chemical Industry:
In the chemical industry, 2,5-Dibromo-3-isopropyl-6-methylbenzoquinone is used as a dye due to its unique color properties. Its chemical structure allows it to impart specific hues to various materials, making it a useful component in the production of dyes and pigments.
Used in Research and Development:
2,5-Dibromo-3-isopropyl-6-methylbenzoquinone is also used as a metabolite in research and development, particularly in the study of biological processes and the development of new compounds with potential applications in various fields. Its unique structure and properties make it an interesting subject for scientific investigation and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 29096-93-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,0,9 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 29096-93:
(7*2)+(6*9)+(5*0)+(4*9)+(3*6)+(2*9)+(1*3)=143
143 % 10 = 3
So 29096-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Br2O2/c1-4(2)6-8(12)9(13)5(3)7(11)10(6)14/h4H,1-3H3
29096-93-3Relevant articles and documents
NADPH and ferredoxin:NADP+ oxidoreductase-dependent reduction of quinones and their reoxidation
Bojko, Monika,Wieckowski, Stanislaw
, p. 203 - 208 (1999)
Molecular oxygen uptake was initiated by adding NADPH (1 mM) to the buffered medium containing 0.6 μM spinach ferredoxin:NADP+ oxidoreductase and 20 μM quinone (plastoquinone-2, decyl-plastoquinone, decyl-ubiquinone, or duroquinone). At pH 7.7 the rate of oxygen uptake was 2- to 12-fold higher during an initial phase (V1) than in a subsequent phase (V2). Except for duroquinone, the initial rate of oxygen consumption was ca. 2.7-fold higher in alkaline than in acidic medium. Ferredoxin was not essential, although it stimulated the reaction investigated. Oxygen uptake was not detectable with plastoquinone-9 or α-tocoquinone. The possible mechanisms of the NADPH and ferredoxin:NADP oxidoreductase dependent reduction of some quinones and their reoxidation are discussed.
