29592-76-5 Usage
General Description
Monoiodotyrosine is a naturally occurring chemical compound that is crucial for the production of thyroid hormones in the human body. It is formed through a series of enzymatic reactions within the thyroid gland, and represents an intermediate step in the biosynthesis of thyroid hormones. Monoiodotyrosine is produced from the amino acid tyrosine through the action of an enzyme called thyroperoxidase, which adds a single iodine atom to the tyrosine molecule. This iodinated tyrosine compound then serves as a precursor for the further synthesis of the thyroid hormones triiodothyronine (T3) and thyroxine (T4). These hormones play a central role in regulating metabolism, growth, and development in the body. Overall, Monoiodotyrosine is a crucial chemical component in the complex process of thyroid hormone production and homeostasis.
Check Digit Verification of cas no
The CAS Registry Mumber 29592-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,9 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29592-76:
(7*2)+(6*9)+(5*5)+(4*9)+(3*2)+(2*7)+(1*6)=155
155 % 10 = 5
So 29592-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10INO3/c10-11-8(9(13)14)5-6-1-3-7(12)4-2-6/h1-4,8,11-12H,5H2,(H,13,14)/t8-/m0/s1